About trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol
trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol (PubChem CID 54292427) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol.
Molecular Properties
| Compound Name | trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol |
| PubChem CID | 54292427 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol |
| SMILES | CC(C)[C@@H]1CCC(C)(O)[C@H](O)C1 |
| InChI | InChI=1S/C10H20O2/c1-7(2)8-4-5-10(3,12)9(11)6-8/h7-9,11-12H,4-6H2,1-3H3/t8-,9-,10?/m1/s1 |
| InChIKey | RYLFWQILVNWPEL-MGRQHWMJSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol?
The IUPAC name of trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol (CID 54292427) is trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol.
What is the SMILES notation for trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol?
The canonical SMILES for trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol is CC(C)[C@@H]1CCC(C)(O)[C@H](O)C1.
What is the InChIKey of trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol?
The InChIKey is RYLFWQILVNWPEL-MGRQHWMJSA-N. The full InChI is InChI=1S/C10H20O2/c1-7(2)8-4-5-10(3,12)9(11)6-8/h7-9,11-12H,4-6H2,1-3H3/t8-,9-,10?/m1/s1.
What are the key properties of trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol?
trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol has a molecular weight of 172.27 g/mol, XLogP of 1.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,4R)-1-methyl-4-propan-2-ylcyclohexane-1,2-diol is sourced from PubChem (CID 54292427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).