C28H50O6 — CID 54292906
[3-(acetyloxymethyl)-12-(1-ethoxyethoxy)-7,11,15-trimethylhexadeca-2,14-dienyl] acetate (PubChem CID 54292906) has the molecular formula C28H50O6 and a molecular weight of 482.70 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-12-(1-ethoxyethoxy)-7,11,15-trimethylhexadeca-2,14-dienyl] acetate.
| Compound Name | [3-(acetyloxymethyl)-12-(1-ethoxyethoxy)-7,11,15-trimethylhexadeca-2,14-dienyl] acetate |
|---|---|
| PubChem CID | 54292906 |
| Molecular Formula | C28H50O6 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | [3-(acetyloxymethyl)-12-(1-ethoxyethoxy)-7,11,15-trimethylhexadeca-2,14-dienyl] acetate |
| SMILES | CCOC(C)OC(CC=C(C)C)C(C)CCCC(C)CCCC(=CCOC(C)=O)COC(C)=O |
| InChI | InChI=1S/C28H50O6/c1-9-31-26(8)34-28(17-16-21(2)3)23(5)14-10-12-22(4)13-11-15-27(20-33-25(7)30)18-19-32-24(6)29/h16,18,22-23,26,28H,9-15,17,19-20H2,1-8H3 |
| InChIKey | RYTIJYHODNLIMN-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|