About 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one
3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one (PubChem CID 5429368) has the molecular formula C21H18N2O4S
and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one |
| PubChem CID | 5429368 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one |
| SMILES | O=c1c(-c2nc3ccccc3s2)coc2c(CN3CCOCC3)c(O)ccc12 |
| InChI | InChI=1S/C21H18N2O4S/c24-17-6-5-13-19(25)15(21-22-16-3-1-2-4-18(16)28-21)12-27-20(13)14(17)11-23-7-9-26-10-8-23/h1-6,12,24H,7-11H2 |
| InChIKey | PAYYMNNDABOJJL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one?
The IUPAC name of 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one (CID 5429368) is 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one.
What is the SMILES notation for 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one?
The canonical SMILES for 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one is O=c1c(-c2nc3ccccc3s2)coc2c(CN3CCOCC3)c(O)ccc12.
What is the InChIKey of 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one?
The InChIKey is PAYYMNNDABOJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4S/c24-17-6-5-13-19(25)15(21-22-16-3-1-2-4-18(16)28-21)12-27-20(13)14(17)11-23-7-9-26-10-8-23/h1-6,12,24H,7-11H2.
What are the key properties of 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one?
3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one has a molecular weight of 394.45 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)chromen-4-one is sourced from PubChem (CID 5429368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).