C27H38N2O — CID 54293839
N-[(5-tert-butyl-2-propan-2-yloxyphenyl)methyl]-2-phenyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-3-amine (PubChem CID 54293839) has the molecular formula C27H38N2O and a molecular weight of 406.61 g/mol. Its IUPAC name is N-[(5-tert-butyl-2-propan-2-yloxyphenyl)methyl]-2-phenyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-3-amine.
| Compound Name | N-[(5-tert-butyl-2-propan-2-yloxyphenyl)methyl]-2-phenyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-3-amine |
|---|---|
| PubChem CID | 54293839 |
| Molecular Formula | C27H38N2O |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | N-[(5-tert-butyl-2-propan-2-yloxyphenyl)methyl]-2-phenyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-3-amine |
| SMILES | CC(C)Oc1ccc(C(C)(C)C)cc1CNC1C(c2ccccc2)NC2CCCC21 |
| InChI | InChI=1S/C27H38N2O/c1-18(2)30-24-15-14-21(27(3,4)5)16-20(24)17-28-26-22-12-9-13-23(22)29-25(26)19-10-7-6-8-11-19/h6-8,10-11,14-16,18,22-23,25-26,28-29H,9,12-13,17H2,1-5H3 |
| InChIKey | RZJXMQDBDHKXED-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |