C18H27N5O5 — CID 54294096
1,3-bis(6-isocyanatohexyl)-5-methyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 54294096) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1,3-bis(6-isocyanatohexyl)-5-methyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(6-isocyanatohexyl)-5-methyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54294096 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1,3-bis(6-isocyanatohexyl)-5-methyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(CCCCCCN=C=O)c(=O)n(CCCCCCN=C=O)c1=O |
| InChI | InChI=1S/C18H27N5O5/c1-21-16(26)22(12-8-4-2-6-10-19-14-24)18(28)23(17(21)27)13-9-5-3-7-11-20-15-25/h2-13H2,1H3 |
| InChIKey | RZOKFKREPQXWDV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 124.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|