C24H42O3 — CID 54294161
7-[(1R,2R,3S,4S)-3-(3-ethyloct-3-enoxy)-2-bicyclo[2.2.1]heptanyl]heptanoic acid (PubChem CID 54294161) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(3-ethyloct-3-enoxy)-2-bicyclo[2.2.1]heptanyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(3-ethyloct-3-enoxy)-2-bicyclo[2.2.1]heptanyl]heptanoic acid |
|---|---|
| PubChem CID | 54294161 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(3-ethyloct-3-enoxy)-2-bicyclo[2.2.1]heptanyl]heptanoic acid |
| SMILES | CCCCC=C(CC)CCO[C@H]1[C@H]2CC[C@H](C2)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C24H42O3/c1-3-5-8-11-19(4-2)16-17-27-24-21-15-14-20(18-21)22(24)12-9-6-7-10-13-23(25)26/h11,20-22,24H,3-10,12-18H2,1-2H3,(H,25,26)/t20-,21+,22-,24+/m1/s1 |
| InChIKey | RZPMTLIISYYYKS-GBAAUQCPSA-N |
| XLogP | 6.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|