About N'-ethyl-N,2-dimethylbut-2-enediamide
N'-ethyl-N,2-dimethylbut-2-enediamide (PubChem CID 54294170) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is N'-ethyl-N,2-dimethylbut-2-enediamide.
Molecular Properties
| Compound Name | N'-ethyl-N,2-dimethylbut-2-enediamide |
| PubChem CID | 54294170 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | N'-ethyl-N,2-dimethylbut-2-enediamide |
| SMILES | CCNC(=O)C=C(C)C(=O)NC |
| InChI | InChI=1S/C8H14N2O2/c1-4-10-7(11)5-6(2)8(12)9-3/h5H,4H2,1-3H3,(H,9,12)(H,10,11) |
| InChIKey | RZPQDYYMALDNRO-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N,2-dimethylbut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N,2-dimethylbut-2-enediamide?
The IUPAC name of N'-ethyl-N,2-dimethylbut-2-enediamide (CID 54294170) is N'-ethyl-N,2-dimethylbut-2-enediamide.
What is the SMILES notation for N'-ethyl-N,2-dimethylbut-2-enediamide?
The canonical SMILES for N'-ethyl-N,2-dimethylbut-2-enediamide is CCNC(=O)C=C(C)C(=O)NC.
What is the InChIKey of N'-ethyl-N,2-dimethylbut-2-enediamide?
The InChIKey is RZPQDYYMALDNRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-4-10-7(11)5-6(2)8(12)9-3/h5H,4H2,1-3H3,(H,9,12)(H,10,11).
What are the key properties of N'-ethyl-N,2-dimethylbut-2-enediamide?
N'-ethyl-N,2-dimethylbut-2-enediamide has a molecular weight of 170.21 g/mol, XLogP of -0.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N,2-dimethylbut-2-enediamide is sourced from PubChem (CID 54294170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).