About 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol
3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol (PubChem CID 54294339) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol |
| PubChem CID | 54294339 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol |
| SMILES | CC=CCc1c(O)[nH]c(O)c1C |
| InChI | InChI=1S/C9H13NO2/c1-3-4-5-7-6(2)8(11)10-9(7)12/h3-4,10-12H,5H2,1-2H3 |
| InChIKey | RZSZCAYFNDRDOK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol?
The IUPAC name of 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol (CID 54294339) is 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol.
What is the SMILES notation for 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol?
The canonical SMILES for 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol is CC=CCc1c(O)[nH]c(O)c1C.
What is the InChIKey of 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol?
The InChIKey is RZSZCAYFNDRDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-3-4-5-7-6(2)8(11)10-9(7)12/h3-4,10-12H,5H2,1-2H3.
What are the key properties of 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol?
3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol has a molecular weight of 167.21 g/mol, XLogP of 1.85, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-enyl-4-methyl-1H-pyrrole-2,5-diol is sourced from PubChem (CID 54294339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).