C25H42N2O2 — CID 54294603
N-icosa-5,8,11,14-tetraenylmorpholine-4-carboxamide (PubChem CID 54294603) has the molecular formula C25H42N2O2 and a molecular weight of 402.62 g/mol. Its IUPAC name is N-icosa-5,8,11,14-tetraenylmorpholine-4-carboxamide.
| Compound Name | N-icosa-5,8,11,14-tetraenylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 54294603 |
| Molecular Formula | C25H42N2O2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | N-icosa-5,8,11,14-tetraenylmorpholine-4-carboxamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCNC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H42N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-25(28)27-21-23-29-24-22-27/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-24H2,1H3,(H,26,28) |
| InChIKey | RZXHODDKSJVFHT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|