C28H33N3O2 — CID 54294949
5-ethyl-2-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[1H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-4,6-diol (PubChem CID 54294949) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 5-ethyl-2-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[1H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-4,6-diol.
| Compound Name | 5-ethyl-2-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[1H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-4,6-diol |
|---|---|
| PubChem CID | 54294949 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 5-ethyl-2-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[1H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-4,6-diol |
| SMILES | CCn1c(O)c2c(c1O)C1(CCN([C@@H]3CCCc4ccccc43)CC1)N(c1ccccc1)C2 |
| InChI | InChI=1S/C28H33N3O2/c1-2-30-26(32)23-19-31(21-11-4-3-5-12-21)28(25(23)27(30)33)15-17-29(18-16-28)24-14-8-10-20-9-6-7-13-22(20)24/h3-7,9,11-13,24,32-33H,2,8,10,14-19H2,1H3/t24-/m1/s1 |
| InChIKey | SADRPAVPJPNGKR-XMMPIXPASA-N |
| XLogP | 5.31 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |