About 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol
3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol (PubChem CID 54295254) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol.
Molecular Properties
| Compound Name | 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol |
| PubChem CID | 54295254 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol |
| SMILES | OCCC(CCO)=C(CCO)CCO |
| InChI | InChI=1S/C10H20O4/c11-5-1-9(2-6-12)10(3-7-13)4-8-14/h11-14H,1-8H2 |
| InChIKey | SAIVLLBTDLSUKA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol?
The IUPAC name of 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol (CID 54295254) is 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol.
What is the SMILES notation for 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol?
The canonical SMILES for 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol is OCCC(CCO)=C(CCO)CCO.
What is the InChIKey of 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol?
The InChIKey is SAIVLLBTDLSUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c11-5-1-9(2-6-12)10(3-7-13)4-8-14/h11-14H,1-8H2.
What are the key properties of 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol?
3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol has a molecular weight of 204.27 g/mol, XLogP of -0.19, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(2-hydroxyethyl)hex-3-ene-1,6-diol is sourced from PubChem (CID 54295254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).