C21H32F2O4 — CID 54295781
(2R)-7-[(1R,2R,3R)-2-(4,4-difluorooct-1-enyl)-3-methyl-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid (PubChem CID 54295781) has the molecular formula C21H32F2O4 and a molecular weight of 386.48 g/mol. Its IUPAC name is (2R)-7-[(1R,2R,3R)-2-(4,4-difluorooct-1-enyl)-3-methyl-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid.
| Compound Name | (2R)-7-[(1R,2R,3R)-2-(4,4-difluorooct-1-enyl)-3-methyl-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 54295781 |
| Molecular Formula | C21H32F2O4 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (2R)-7-[(1R,2R,3R)-2-(4,4-difluorooct-1-enyl)-3-methyl-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
| SMILES | CCCCC(F)(F)CC=C[C@H]1[C@H](C)CC(=O)[C@@H]1CC=CCC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C21H32F2O4/c1-3-4-12-21(22,23)13-8-10-16-15(2)14-19(25)17(16)9-6-5-7-11-18(24)20(26)27/h5-6,8,10,15-18,24H,3-4,7,9,11-14H2,1-2H3,(H,26,27)/t15-,16+,17-,18-/m1/s1 |
| InChIKey | SARRRWGJLSFKMJ-XMTFNYHQSA-N |
| XLogP | 4.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|