C25H38NO7P — CID 54296346
(2S)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-phosphonooxypropanoic acid (PubChem CID 54296346) has the molecular formula C25H38NO7P and a molecular weight of 495.55 g/mol. Its IUPAC name is (2S)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-phosphonooxypropanoic acid.
| Compound Name | (2S)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-phosphonooxypropanoic acid |
|---|---|
| PubChem CID | 54296346 |
| Molecular Formula | C25H38NO7P |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (2S)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-phosphonooxypropanoic acid |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)N[C@@H](COP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C25H38NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(27)26-23(25(28)29)22-33-34(30,31)32/h10-21,23H,2-9,22H2,1H3,(H,26,27)(H,28,29)(H2,30,31,32)/t23-/m0/s1 |
| InChIKey | SBAVEUFTMHICNP-QHCPKHFHSA-N |
| XLogP | 5.14 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|