About 5-methylnon-1-en-8-yne
5-methylnon-1-en-8-yne (PubChem CID 54296500) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is 5-methylnon-1-en-8-yne.
Molecular Properties
| Compound Name | 5-methylnon-1-en-8-yne |
| PubChem CID | 54296500 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 5-methylnon-1-en-8-yne |
| SMILES | C#CCCC(C)CCC=C |
| InChI | InChI=1S/C10H16/c1-4-6-8-10(3)9-7-5-2/h1,5,10H,2,6-9H2,3H3 |
| InChIKey | STHAIBJOVPHHAB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methylnon-1-en-8-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylnon-1-en-8-yne?
The IUPAC name of 5-methylnon-1-en-8-yne (CID 54296500) is 5-methylnon-1-en-8-yne.
What is the SMILES notation for 5-methylnon-1-en-8-yne?
The canonical SMILES for 5-methylnon-1-en-8-yne is C#CCCC(C)CCC=C.
What is the InChIKey of 5-methylnon-1-en-8-yne?
The InChIKey is STHAIBJOVPHHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-4-6-8-10(3)9-7-5-2/h1,5,10H,2,6-9H2,3H3.
What are the key properties of 5-methylnon-1-en-8-yne?
5-methylnon-1-en-8-yne has a molecular weight of 136.24 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylnon-1-en-8-yne is sourced from PubChem (CID 54296500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).