C16H28O7S — CID 54296591
propan-2-yl 2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)ethanesulfinate (PubChem CID 54296591) has the molecular formula C16H28O7S and a molecular weight of 364.46 g/mol. Its IUPAC name is propan-2-yl 2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)ethanesulfinate.
| Compound Name | propan-2-yl 2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)ethanesulfinate |
|---|---|
| PubChem CID | 54296591 |
| Molecular Formula | C16H28O7S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | propan-2-yl 2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)ethanesulfinate |
| SMILES | CC(C)OS(=O)CCC1OC2OC(C)(C)OC2C2OC(C)(C)OC12 |
| InChI | InChI=1S/C16H28O7S/c1-9(2)23-24(17)8-7-10-11-12(20-15(3,4)19-11)13-14(18-10)22-16(5,6)21-13/h9-14H,7-8H2,1-6H3 |
| InChIKey | SBEXOKPEYOUNQJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |