About 3-benzyl-4-hydroxy-1,3-thiazole-2-thione
3-benzyl-4-hydroxy-1,3-thiazole-2-thione (PubChem CID 54296987) has the molecular formula C10H9NOS2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-benzyl-4-hydroxy-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 3-benzyl-4-hydroxy-1,3-thiazole-2-thione |
| PubChem CID | 54296987 |
| Molecular Formula | C10H9NOS2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 3-benzyl-4-hydroxy-1,3-thiazole-2-thione |
| SMILES | Oc1csc(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C10H9NOS2/c12-9-7-14-10(13)11(9)6-8-4-2-1-3-5-8/h1-5,7,12H,6H2 |
| InChIKey | SBLXTHMCTSJDNW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4-hydroxy-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4-hydroxy-1,3-thiazole-2-thione?
The IUPAC name of 3-benzyl-4-hydroxy-1,3-thiazole-2-thione (CID 54296987) is 3-benzyl-4-hydroxy-1,3-thiazole-2-thione.
What is the SMILES notation for 3-benzyl-4-hydroxy-1,3-thiazole-2-thione?
The canonical SMILES for 3-benzyl-4-hydroxy-1,3-thiazole-2-thione is Oc1csc(=S)n1Cc1ccccc1.
What is the InChIKey of 3-benzyl-4-hydroxy-1,3-thiazole-2-thione?
The InChIKey is SBLXTHMCTSJDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS2/c12-9-7-14-10(13)11(9)6-8-4-2-1-3-5-8/h1-5,7,12H,6H2.
What are the key properties of 3-benzyl-4-hydroxy-1,3-thiazole-2-thione?
3-benzyl-4-hydroxy-1,3-thiazole-2-thione has a molecular weight of 223.32 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4-hydroxy-1,3-thiazole-2-thione is sourced from PubChem (CID 54296987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).