About 3-methyliminopropanamide
3-methyliminopropanamide (PubChem CID 54297229) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 3-methyliminopropanamide.
Molecular Properties
| Compound Name | 3-methyliminopropanamide |
| PubChem CID | 54297229 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 3-methyliminopropanamide |
| SMILES | C/N=C/CC(N)=O |
| InChI | InChI=1S/C4H8N2O/c1-6-3-2-4(5)7/h3H,2H2,1H3,(H2,5,7)/b6-3+ |
| InChIKey | SBQHTBPDOIJFLY-ZZXKWVIFSA-N |
| XLogP | -0.44 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyliminopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyliminopropanamide?
The IUPAC name of 3-methyliminopropanamide (CID 54297229) is 3-methyliminopropanamide.
What is the SMILES notation for 3-methyliminopropanamide?
The canonical SMILES for 3-methyliminopropanamide is C/N=C/CC(N)=O.
What is the InChIKey of 3-methyliminopropanamide?
The InChIKey is SBQHTBPDOIJFLY-ZZXKWVIFSA-N. The full InChI is InChI=1S/C4H8N2O/c1-6-3-2-4(5)7/h3H,2H2,1H3,(H2,5,7)/b6-3+.
What are the key properties of 3-methyliminopropanamide?
3-methyliminopropanamide has a molecular weight of 100.12 g/mol, XLogP of -0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyliminopropanamide is sourced from PubChem (CID 54297229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).