C7H8F7NO — CID 54297752
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)morpholine (PubChem CID 54297752) has the molecular formula C7H8F7NO and a molecular weight of 255.13 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)morpholine.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)morpholine |
|---|---|
| PubChem CID | 54297752 |
| Molecular Formula | C7H8F7NO |
| Molecular Weight | 255.13 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)morpholine |
| SMILES | FC(F)(F)C(F)(N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C7H8F7NO/c8-5(6(9,10)11,7(12,13)14)15-1-3-16-4-2-15/h1-4H2 |
| InChIKey | SBZBSJMIHAQJMK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|