C11H18N2O2 — CID 54298057
2,4,7-trimethylocta-2,6-dienediamide (PubChem CID 54298057) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2,4,7-trimethylocta-2,6-dienediamide.
| Compound Name | 2,4,7-trimethylocta-2,6-dienediamide |
|---|---|
| PubChem CID | 54298057 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2,4,7-trimethylocta-2,6-dienediamide |
| SMILES | CC(=CCC(C)C=C(C)C(N)=O)C(N)=O |
| InChI | InChI=1S/C11H18N2O2/c1-7(6-9(3)11(13)15)4-5-8(2)10(12)14/h5-7H,4H2,1-3H3,(H2,12,14)(H2,13,15) |
| InChIKey | SCEICQWBUFWUMP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|