C27H44NO2+ — CID 54299321
2-docosa-2,4,6,8,10,12-hexaenoyloxyethyl(trimethyl)azanium (PubChem CID 54299321) has the molecular formula C27H44NO2+ and a molecular weight of 414.65 g/mol. Its IUPAC name is 2-docosa-2,4,6,8,10,12-hexaenoyloxyethyl(trimethyl)azanium.
| Compound Name | 2-docosa-2,4,6,8,10,12-hexaenoyloxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 54299321 |
| Molecular Formula | C27H44NO2+ |
| Molecular Weight | 414.65 g/mol |
| Exact Mass | 414.34 |
| IUPAC Name | 2-docosa-2,4,6,8,10,12-hexaenoyloxyethyl(trimethyl)azanium |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C27H44NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27(29)30-26-25-28(2,3)4/h13-24H,5-12,25-26H2,1-4H3/q+1 |
| InChIKey | SDBRXCGIZQXIEC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|