About 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol
2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol (PubChem CID 54299704) has the molecular formula C28H26O2
and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol |
| PubChem CID | 54299704 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol |
| SMILES | CC=Cc1c(C=Cc2ccccc2)c(C=Cc2ccccc2)cc(O)c1CC1CO1 |
| InChI | InChI=1S/C28H26O2/c1-2-9-26-25(17-15-22-12-7-4-8-13-22)23(16-14-21-10-5-3-6-11-21)18-28(29)27(26)19-24-20-30-24/h2-18,24,29H,19-20H2,1H3 |
| InChIKey | SDIIEUKUTLUJIL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol?
The IUPAC name of 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol (CID 54299704) is 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol.
What is the SMILES notation for 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol?
The canonical SMILES for 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol is CC=Cc1c(C=Cc2ccccc2)c(C=Cc2ccccc2)cc(O)c1CC1CO1.
What is the InChIKey of 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol?
The InChIKey is SDIIEUKUTLUJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26O2/c1-2-9-26-25(17-15-22-12-7-4-8-13-22)23(16-14-21-10-5-3-6-11-21)18-28(29)27(26)19-24-20-30-24/h2-18,24,29H,19-20H2,1H3.
What are the key properties of 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol?
2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol has a molecular weight of 394.51 g/mol, XLogP of 6.71, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethyl)-4,5-bis(2-phenylethenyl)-3-prop-1-enylphenol is sourced from PubChem (CID 54299704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).