About 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid
4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid (PubChem CID 54299721) has the molecular formula C13H11IN2O8S
and a molecular weight of 482.21 g/mol. Its IUPAC name is 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid |
| PubChem CID | 54299721 |
| Molecular Formula | C13H11IN2O8S |
| Molecular Weight | 482.21 g/mol |
| Exact Mass | 481.93 |
| IUPAC Name | 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(C(=O)CI)n2c(O)cc(S(=O)(=O)O)c2O)cc1 |
| InChI | InChI=1S/C13H11IN2O8S/c14-6-11(18)15(8-3-1-7(2-4-8)13(20)21)16-10(17)5-9(12(16)19)25(22,23)24/h1-5,17,19H,6H2,(H,20,21)(H,22,23,24) |
| InChIKey | SDIOEABTDMMLQG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 157.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid?
The IUPAC name of 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid (CID 54299721) is 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid.
What is the SMILES notation for 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid?
The canonical SMILES for 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid is O=C(O)c1ccc(N(C(=O)CI)n2c(O)cc(S(=O)(=O)O)c2O)cc1.
What is the InChIKey of 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid?
The InChIKey is SDIOEABTDMMLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11IN2O8S/c14-6-11(18)15(8-3-1-7(2-4-8)13(20)21)16-10(17)5-9(12(16)19)25(22,23)24/h1-5,17,19H,6H2,(H,20,21)(H,22,23,24).
What are the key properties of 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid?
4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid has a molecular weight of 482.21 g/mol, XLogP of 1.08, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dihydroxy-3-sulfopyrrol-1-yl)-(2-iodoacetyl)amino]benzoic acid is sourced from PubChem (CID 54299721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).