About 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one
5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one (PubChem CID 54300343) has the molecular formula C11H15F6NO
and a molecular weight of 291.24 g/mol. Its IUPAC name is 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one |
| PubChem CID | 54300343 |
| Molecular Formula | C11H15F6NO |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one |
| SMILES | CCCCCC1NC(=O)CC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F6NO/c1-2-3-4-5-7-9(10(12,13)14,11(15,16)17)6-8(19)18-7/h7H,2-6H2,1H3,(H,18,19) |
| InChIKey | SDSVBEDGXBDBME-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one?
The IUPAC name of 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one (CID 54300343) is 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one.
What is the SMILES notation for 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one?
The canonical SMILES for 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one is CCCCCC1NC(=O)CC1(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one?
The InChIKey is SDSVBEDGXBDBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F6NO/c1-2-3-4-5-7-9(10(12,13)14,11(15,16)17)6-8(19)18-7/h7H,2-6H2,1H3,(H,18,19).
What are the key properties of 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one?
5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one has a molecular weight of 291.24 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentyl-4,4-bis(trifluoromethyl)pyrrolidin-2-one is sourced from PubChem (CID 54300343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).