C16H13FN2O2 — CID 54300452
3-benzyl-8-fluoro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 54300452) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-benzyl-8-fluoro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 3-benzyl-8-fluoro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 54300452 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-benzyl-8-fluoro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1NC(Cc2ccccc2)C(=O)Nc2cc(F)ccc21 |
| InChI | InChI=1S/C16H13FN2O2/c17-11-6-7-12-13(9-11)18-16(21)14(19-15(12)20)8-10-4-2-1-3-5-10/h1-7,9,14H,8H2,(H,18,21)(H,19,20) |
| InChIKey | SDUUJSASXJCSHU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |