C15H19NO4 — CID 54300749
2-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)-3-methylbutanoic acid (PubChem CID 54300749) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)-3-methylbutanoic acid.
| Compound Name | 2-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54300749 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)n1c(O)c2c(c1O)C1C=CC2CC1 |
| InChI | InChI=1S/C15H19NO4/c1-7(2)12(15(19)20)16-13(17)10-8-3-4-9(6-5-8)11(10)14(16)18/h3-4,7-9,12,17-18H,5-6H2,1-2H3,(H,19,20) |
| InChIKey | SDZLUONAIQXBGO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|