C11H21F3N2 — CID 54300836
N-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 54300836) has the molecular formula C11H21F3N2 and a molecular weight of 238.30 g/mol. Its IUPAC name is N-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 54300836 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | NC[C@@H]1CCC[C@H](CNCCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H21F3N2/c12-11(13,14)4-5-16-8-10-3-1-2-9(6-10)7-15/h9-10,16H,1-8,15H2/t9-,10+/m1/s1 |
| InChIKey | SEASKDXMJOSXMX-ZJUUUORDSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|