About ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate
ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate (PubChem CID 54300866) has the molecular formula C15H19FO3
and a molecular weight of 266.31 g/mol. Its IUPAC name is ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate |
| PubChem CID | 54300866 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate |
| SMILES | CCOC(=O)CC1Cc2cc(F)ccc2OC1(C)C |
| InChI | InChI=1S/C15H19FO3/c1-4-18-14(17)9-11-7-10-8-12(16)5-6-13(10)19-15(11,2)3/h5-6,8,11H,4,7,9H2,1-3H3 |
| InChIKey | SEBIQLKTXNGFMX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate?
The IUPAC name of ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate (CID 54300866) is ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate.
What is the SMILES notation for ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate?
The canonical SMILES for ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate is CCOC(=O)CC1Cc2cc(F)ccc2OC1(C)C.
What is the InChIKey of ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate?
The InChIKey is SEBIQLKTXNGFMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FO3/c1-4-18-14(17)9-11-7-10-8-12(16)5-6-13(10)19-15(11,2)3/h5-6,8,11H,4,7,9H2,1-3H3.
What are the key properties of ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate?
ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate has a molecular weight of 266.31 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-3-yl)acetate is sourced from PubChem (CID 54300866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).