About 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol
4-tricyclo[4.2.0.01,3]oct-7-enylmethanol (PubChem CID 54301959) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol.
Molecular Properties
| Compound Name | 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol |
| PubChem CID | 54301959 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol |
| SMILES | OCC1CC2C=CC23CC13 |
| InChI | InChI=1S/C9H12O/c10-5-6-3-7-1-2-9(7)4-8(6)9/h1-2,6-8,10H,3-5H2 |
| InChIKey | SEVUDEUEVCRBOP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol?
The IUPAC name of 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol (CID 54301959) is 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol.
What is the SMILES notation for 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol?
The canonical SMILES for 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol is OCC1CC2C=CC23CC13.
What is the InChIKey of 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol?
The InChIKey is SEVUDEUEVCRBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c10-5-6-3-7-1-2-9(7)4-8(6)9/h1-2,6-8,10H,3-5H2.
What are the key properties of 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol?
4-tricyclo[4.2.0.01,3]oct-7-enylmethanol has a molecular weight of 136.19 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tricyclo[4.2.0.01,3]oct-7-enylmethanol is sourced from PubChem (CID 54301959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).