C19H29NO2 — CID 54301963
1-[(3R,4S)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]hexan-1-one (PubChem CID 54301963) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[(3R,4S)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]hexan-1-one.
| Compound Name | 1-[(3R,4S)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 54301963 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-[(3R,4S)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CC[C@](C)(c2cccc(O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C19H29NO2/c1-4-5-6-10-18(22)20-12-11-19(3,15(2)14-20)16-8-7-9-17(21)13-16/h7-9,13,15,21H,4-6,10-12,14H2,1-3H3/t15-,19-/m0/s1 |
| InChIKey | SEVWJCLHIPEPAL-KXBFYZLASA-N |
| XLogP | 4.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|