About 2,3-dihydropyrano[3,2-e]indole
2,3-dihydropyrano[3,2-e]indole (PubChem CID 54302224) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2,3-dihydropyrano[3,2-e]indole.
Molecular Properties
| Compound Name | 2,3-dihydropyrano[3,2-e]indole |
| PubChem CID | 54302224 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 2,3-dihydropyrano[3,2-e]indole |
| SMILES | C1=COc2ccc3c(c2=C1)=CCN3 |
| InChI | InChI=1S/C11H9NO/c1-2-9-8-5-6-12-10(8)3-4-11(9)13-7-1/h1-5,7,12H,6H2 |
| InChIKey | SFAQTGXDXGMPOT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydropyrano[3,2-e]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydropyrano[3,2-e]indole?
The IUPAC name of 2,3-dihydropyrano[3,2-e]indole (CID 54302224) is 2,3-dihydropyrano[3,2-e]indole.
What is the SMILES notation for 2,3-dihydropyrano[3,2-e]indole?
The canonical SMILES for 2,3-dihydropyrano[3,2-e]indole is C1=COc2ccc3c(c2=C1)=CCN3.
What is the InChIKey of 2,3-dihydropyrano[3,2-e]indole?
The InChIKey is SFAQTGXDXGMPOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c1-2-9-8-5-6-12-10(8)3-4-11(9)13-7-1/h1-5,7,12H,6H2.
What are the key properties of 2,3-dihydropyrano[3,2-e]indole?
2,3-dihydropyrano[3,2-e]indole has a molecular weight of 171.20 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydropyrano[3,2-e]indole is sourced from PubChem (CID 54302224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).