C34H31NO4 — CID 54302374
2-[5-[3-(N-benzhydrylanilino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid (PubChem CID 54302374) has the molecular formula C34H31NO4 and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-[5-[3-(N-benzhydrylanilino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[5-[3-(N-benzhydrylanilino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 54302374 |
| Molecular Formula | C34H31NO4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 2-[5-[3-(N-benzhydrylanilino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1cccc2c1CCCC2CCC(=O)N(c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H31NO4/c36-31(23-22-24-16-10-20-29-28(24)19-11-21-30(29)33(37)34(38)39)35(27-17-8-3-9-18-27)32(25-12-4-1-5-13-25)26-14-6-2-7-15-26/h1-9,11-15,17-19,21,24,32H,10,16,20,22-23H2,(H,38,39) |
| InChIKey | SFDJHWPNFRTYAZ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|