C12H16O4 — CID 54302564
2,2-dimethyl-5-(4-methylpent-3-en-2-ylidene)-1,3-dioxane-4,6-dione (PubChem CID 54302564) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,2-dimethyl-5-(4-methylpent-3-en-2-ylidene)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(4-methylpent-3-en-2-ylidene)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 54302564 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2,2-dimethyl-5-(4-methylpent-3-en-2-ylidene)-1,3-dioxane-4,6-dione |
| SMILES | CC(C)=CC(C)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C12H16O4/c1-7(2)6-8(3)9-10(13)15-12(4,5)16-11(9)14/h6H,1-5H3 |
| InChIKey | SFGXQBOSJFRWRU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|