C10H18N2 — CID 54302636
(3aS,7aR)-N,7-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine (PubChem CID 54302636) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (3aS,7aR)-N,7-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine.
| Compound Name | (3aS,7aR)-N,7-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
|---|---|
| PubChem CID | 54302636 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3aS,7aR)-N,7-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
| SMILES | CNC1C=CC(C)[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C10H18N2/c1-7-3-4-10(11-2)9-6-12-5-8(7)9/h3-4,7-12H,5-6H2,1-2H3/t7?,8-,9-,10?/m1/s1 |
| InChIKey | SFIBLXYGWQPAOY-DSAQSWLYSA-N |
| XLogP | 0.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|