C14H3Cl2F13N2S — CID 54302763
N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(1,2,2,2-tetrafluoroethylidene)-4,4-bis(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 54302763) has the molecular formula C14H3Cl2F13N2S and a molecular weight of 549.14 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(1,2,2,2-tetrafluoroethylidene)-4,4-bis(trifluoromethyl)-1,3-thiazol-2-amine.
| Compound Name | N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(1,2,2,2-tetrafluoroethylidene)-4,4-bis(trifluoromethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 54302763 |
| Molecular Formula | C14H3Cl2F13N2S |
| Molecular Weight | 549.14 g/mol |
| Exact Mass | 547.92 |
| IUPAC Name | N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(1,2,2,2-tetrafluoroethylidene)-4,4-bis(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | FC(=C1SC(Nc2c(Cl)cc(C(F)(F)F)cc2Cl)=NC1(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H3Cl2F13N2S/c15-4-1-3(11(18,19)20)2-5(16)6(4)30-9-31-10(13(24,25)26,14(27,28)29)8(32-9)7(17)12(21,22)23/h1-2H,(H,30,31) |
| InChIKey | SFKACWNACJHVCE-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.14 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |