C15H11F4N5O5 — CID 5430303
2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide (PubChem CID 5430303) has the molecular formula C15H11F4N5O5 and a molecular weight of 417.28 g/mol. Its IUPAC name is 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5430303 |
| Molecular Formula | C15H11F4N5O5 |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| SMILES | O=C(Cn1nc(C(F)F)cc1C(F)F)N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C15H11F4N5O5/c16-14(17)8-2-10(15(18)19)23(22-8)5-13(25)21-20-4-7-1-11-12(29-6-28-11)3-9(7)24(26)27/h1-4,14-15H,5-6H2,(H,21,25)/b20-4- |
| InChIKey | BFMLDWMOSXIRAR-YQLNASGTSA-N |
| XLogP | 2.55 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|