C12H12BrF3O — CID 54303916
(1S,2S)-2-bromo-3,3-dimethyl-5-(trifluoromethyl)-1,2-dihydroinden-1-ol (PubChem CID 54303916) has the molecular formula C12H12BrF3O and a molecular weight of 309.13 g/mol. Its IUPAC name is (1S,2S)-2-bromo-3,3-dimethyl-5-(trifluoromethyl)-1,2-dihydroinden-1-ol.
| Compound Name | (1S,2S)-2-bromo-3,3-dimethyl-5-(trifluoromethyl)-1,2-dihydroinden-1-ol |
|---|---|
| PubChem CID | 54303916 |
| Molecular Formula | C12H12BrF3O |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | (1S,2S)-2-bromo-3,3-dimethyl-5-(trifluoromethyl)-1,2-dihydroinden-1-ol |
| SMILES | CC1(C)c2cc(C(F)(F)F)ccc2[C@H](O)[C@H]1Br |
| InChI | InChI=1S/C12H12BrF3O/c1-11(2)8-5-6(12(14,15)16)3-4-7(8)9(17)10(11)13/h3-5,9-10,17H,1-2H3/t9-,10+/m0/s1 |
| InChIKey | SGDKAEKCQJMODN-VHSXEESVSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|