C34H36N2O6 — CID 54303920
bis(2-methylbutan-2-yl) 2,9-dimethyl-7,14-dioxoquinolino[2,3-b]acridine-5,12-dicarboxylate (PubChem CID 54303920) has the molecular formula C34H36N2O6 and a molecular weight of 568.67 g/mol. Its IUPAC name is bis(2-methylbutan-2-yl) 2,9-dimethyl-7,14-dioxoquinolino[2,3-b]acridine-5,12-dicarboxylate.
| Compound Name | bis(2-methylbutan-2-yl) 2,9-dimethyl-7,14-dioxoquinolino[2,3-b]acridine-5,12-dicarboxylate |
|---|---|
| PubChem CID | 54303920 |
| Molecular Formula | C34H36N2O6 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | bis(2-methylbutan-2-yl) 2,9-dimethyl-7,14-dioxoquinolino[2,3-b]acridine-5,12-dicarboxylate |
| SMILES | CCC(C)(C)OC(=O)n1c2ccc(C)cc2c(=O)c2cc3c(cc21)c(=O)c1cc(C)ccc1n3C(=O)OC(C)(C)CC |
| InChI | InChI=1S/C34H36N2O6/c1-9-33(5,6)41-31(39)35-25-13-11-19(3)15-21(25)29(37)23-18-28-24(17-27(23)35)30(38)22-16-20(4)12-14-26(22)36(28)32(40)42-34(7,8)10-2/h11-18H,9-10H2,1-8H3 |
| InChIKey | SGDLJLNACJBVFF-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|