About 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one
11-methoxy-6,10-dimethylundeca-5,9-dien-2-one (PubChem CID 54304470) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one.
Molecular Properties
| Compound Name | 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one |
| PubChem CID | 54304470 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one |
| SMILES | COCC(C)=CCCC(C)=CCCC(C)=O |
| InChI | InChI=1S/C14H24O2/c1-12(8-6-10-14(3)15)7-5-9-13(2)11-16-4/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | SGNNTCBXZNBLBJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one?
The IUPAC name of 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one (CID 54304470) is 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one.
What is the SMILES notation for 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one?
The canonical SMILES for 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one is COCC(C)=CCCC(C)=CCCC(C)=O.
What is the InChIKey of 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one?
The InChIKey is SGNNTCBXZNBLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-12(8-6-10-14(3)15)7-5-9-13(2)11-16-4/h8-9H,5-7,10-11H2,1-4H3.
What are the key properties of 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one?
11-methoxy-6,10-dimethylundeca-5,9-dien-2-one has a molecular weight of 224.34 g/mol, XLogP of 3.67, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methoxy-6,10-dimethylundeca-5,9-dien-2-one is sourced from PubChem (CID 54304470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).