C13H19NO3 — CID 54304602
(3R,4R,5R)-1-benzyl-5-(hydroxymethyl)piperidine-3,4-diol (PubChem CID 54304602) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (3R,4R,5R)-1-benzyl-5-(hydroxymethyl)piperidine-3,4-diol.
| Compound Name | (3R,4R,5R)-1-benzyl-5-(hydroxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 54304602 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (3R,4R,5R)-1-benzyl-5-(hydroxymethyl)piperidine-3,4-diol |
| SMILES | OC[C@H]1CN(Cc2ccccc2)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H19NO3/c15-9-11-7-14(8-12(16)13(11)17)6-10-4-2-1-3-5-10/h1-5,11-13,15-17H,6-9H2/t11-,12-,13-/m1/s1 |
| InChIKey | SGPVIQCAOCSXHN-JHJVBQTASA-N |
| XLogP | -0.17 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |