About 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid
4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid (PubChem CID 54304932) has the molecular formula C11H15NO3S2
and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid |
| PubChem CID | 54304932 |
| Molecular Formula | C11H15NO3S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)C(=O)NCSc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C11H15NO3S2/c1-11(2,3)10(15)12-6-17-7-4-8(9(13)14)16-5-7/h4-5H,6H2,1-3H3,(H,12,15)(H,13,14) |
| InChIKey | SGVCNENZJVQLHZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid?
The IUPAC name of 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid (CID 54304932) is 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid?
The canonical SMILES for 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid is CC(C)(C)C(=O)NCSc1csc(C(=O)O)c1.
What is the InChIKey of 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid?
The InChIKey is SGVCNENZJVQLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S2/c1-11(2,3)10(15)12-6-17-7-4-8(9(13)14)16-5-7/h4-5H,6H2,1-3H3,(H,12,15)(H,13,14).
What are the key properties of 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid?
4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid has a molecular weight of 273.38 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-dimethylpropanoylamino)methylsulfanyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 54304932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).