C12H17N3S — CID 54305125
1-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-propylphenyl)hydrazine (PubChem CID 54305125) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-propylphenyl)hydrazine.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-propylphenyl)hydrazine |
|---|---|
| PubChem CID | 54305125 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-2-(2-propylphenyl)hydrazine |
| SMILES | CCCc1ccccc1NNC1=NCCS1 |
| InChI | InChI=1S/C12H17N3S/c1-2-5-10-6-3-4-7-11(10)14-15-12-13-8-9-16-12/h3-4,6-7,14H,2,5,8-9H2,1H3,(H,13,15) |
| InChIKey | SGYJRKBTXQNXTI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|