About 5-amino-N,N-dimethyl-2-methylidenepentanamide
5-amino-N,N-dimethyl-2-methylidenepentanamide (PubChem CID 54306059) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 5-amino-N,N-dimethyl-2-methylidenepentanamide.
Molecular Properties
| Compound Name | 5-amino-N,N-dimethyl-2-methylidenepentanamide |
| PubChem CID | 54306059 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 5-amino-N,N-dimethyl-2-methylidenepentanamide |
| SMILES | C=C(CCCN)C(=O)N(C)C |
| InChI | InChI=1S/C8H16N2O/c1-7(5-4-6-9)8(11)10(2)3/h1,4-6,9H2,2-3H3 |
| InChIKey | SHOSENFIHCMYJQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N,N-dimethyl-2-methylidenepentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N,N-dimethyl-2-methylidenepentanamide?
The IUPAC name of 5-amino-N,N-dimethyl-2-methylidenepentanamide (CID 54306059) is 5-amino-N,N-dimethyl-2-methylidenepentanamide.
What is the SMILES notation for 5-amino-N,N-dimethyl-2-methylidenepentanamide?
The canonical SMILES for 5-amino-N,N-dimethyl-2-methylidenepentanamide is C=C(CCCN)C(=O)N(C)C.
What is the InChIKey of 5-amino-N,N-dimethyl-2-methylidenepentanamide?
The InChIKey is SHOSENFIHCMYJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(5-4-6-9)8(11)10(2)3/h1,4-6,9H2,2-3H3.
What are the key properties of 5-amino-N,N-dimethyl-2-methylidenepentanamide?
5-amino-N,N-dimethyl-2-methylidenepentanamide has a molecular weight of 156.23 g/mol, XLogP of 0.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N,N-dimethyl-2-methylidenepentanamide is sourced from PubChem (CID 54306059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).