methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate

C8H11NO3 — CID 54306098

IUPACmethyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate
SMILESCOC(=O)N1CCC=C(C=O)C1
InChIInChI=1S/C8H11NO3/c1-12-8(11)9-4-2-3-7(5-9)6-10/h3,6H,2,4-5H2,1H3
InChIKeySHPSBBZEMQBPLU-UHFFFAOYSA-N
MW169.18 g/mol
LogP0.58
Rot. Bonds1

About methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate

methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 54306098) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate.

Molecular Properties

Compound Namemethyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate
PubChem CID54306098
Molecular FormulaC8H11NO3
Molecular Weight169.18 g/mol
Exact Mass169.07
IUPAC Namemethyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate
SMILESCOC(=O)N1CCC=C(C=O)C1
InChIInChI=1S/C8H11NO3/c1-12-8(11)9-4-2-3-7(5-9)6-10/h3,6H,2,4-5H2,1H3
InChIKeySHPSBBZEMQBPLU-UHFFFAOYSA-N
XLogP0.58
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 50.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 54306098) is methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate is COC(=O)N1CCC=C(C=O)C1.
What is the InChIKey of methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is SHPSBBZEMQBPLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-12-8(11)9-4-2-3-7(5-9)6-10/h3,6H,2,4-5H2,1H3.
What are the key properties of methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate?
methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 169.18 g/mol, XLogP of 0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 54306098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).