About 1-N'-phenylcyclopropane-1,1-dicarboxamide
1-N'-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 54306644) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-N'-phenylcyclopropane-1,1-dicarboxamide.
Molecular Properties
| Compound Name | 1-N'-phenylcyclopropane-1,1-dicarboxamide |
| PubChem CID | 54306644 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-N'-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C11H12N2O2/c12-9(14)11(6-7-11)10(15)13-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,12,14)(H,13,15) |
| InChIKey | SHZKNYAJLNKSTP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-phenylcyclopropane-1,1-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-phenylcyclopropane-1,1-dicarboxamide?
The IUPAC name of 1-N'-phenylcyclopropane-1,1-dicarboxamide (CID 54306644) is 1-N'-phenylcyclopropane-1,1-dicarboxamide.
What is the SMILES notation for 1-N'-phenylcyclopropane-1,1-dicarboxamide?
The canonical SMILES for 1-N'-phenylcyclopropane-1,1-dicarboxamide is NC(=O)C1(C(=O)Nc2ccccc2)CC1.
What is the InChIKey of 1-N'-phenylcyclopropane-1,1-dicarboxamide?
The InChIKey is SHZKNYAJLNKSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c12-9(14)11(6-7-11)10(15)13-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,12,14)(H,13,15).
What are the key properties of 1-N'-phenylcyclopropane-1,1-dicarboxamide?
1-N'-phenylcyclopropane-1,1-dicarboxamide has a molecular weight of 204.23 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-phenylcyclopropane-1,1-dicarboxamide is sourced from PubChem (CID 54306644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).