C19H20ClN — CID 54307557
7-chloro-1-methyl-5-phenyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine (PubChem CID 54307557) has the molecular formula C19H20ClN and a molecular weight of 297.83 g/mol. Its IUPAC name is 7-chloro-1-methyl-5-phenyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine.
| Compound Name | 7-chloro-1-methyl-5-phenyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 54307557 |
| Molecular Formula | C19H20ClN |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 7-chloro-1-methyl-5-phenyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b]pyridine |
| SMILES | CN1CCCC2C(c3ccccc3)c3cc(Cl)ccc3C21 |
| InChI | InChI=1S/C19H20ClN/c1-21-11-5-8-16-18(13-6-3-2-4-7-13)17-12-14(20)9-10-15(17)19(16)21/h2-4,6-7,9-10,12,16,18-19H,5,8,11H2,1H3 |
| InChIKey | SIPGBTKFHJUOAV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |