C44H78N2O4 — CID 54307743
2-(dimethylamino)ethyl N-[2,3-bis(octadeca-9,12,15-trienoxy)propyl]carbamate (PubChem CID 54307743) has the molecular formula C44H78N2O4 and a molecular weight of 699.12 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-[2,3-bis(octadeca-9,12,15-trienoxy)propyl]carbamate.
| Compound Name | 2-(dimethylamino)ethyl N-[2,3-bis(octadeca-9,12,15-trienoxy)propyl]carbamate |
|---|---|
| PubChem CID | 54307743 |
| Molecular Formula | C44H78N2O4 |
| Molecular Weight | 699.12 g/mol |
| Exact Mass | 698.60 |
| IUPAC Name | 2-(dimethylamino)ethyl N-[2,3-bis(octadeca-9,12,15-trienoxy)propyl]carbamate |
| SMILES | CCC=CCC=CCC=CCCCCCCCCOCC(CNC(=O)OCCN(C)C)OCCCCCCCCC=CCC=CCC=CCC |
| InChI | InChI=1S/C44H78N2O4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-48-42-43(41-45-44(47)50-40-37-46(3)4)49-39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h7-10,13-16,19-22,43H,5-6,11-12,17-18,23-42H2,1-4H3,(H,45,47) |
| InChIKey | SISFQDOAHAAYAO-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.12 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|