About S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate
S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate (PubChem CID 54307860) has the molecular formula C18H16FN3O2S
and a molecular weight of 357.41 g/mol. Its IUPAC name is S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate.
Molecular Properties
| Compound Name | S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate |
| PubChem CID | 54307860 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate |
| SMILES | CC1CC(=O)NN=C1c1ccc(NC(=O)Sc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-11-10-16(23)21-22-17(11)12-2-6-14(7-3-12)20-18(24)25-15-8-4-13(19)5-9-15/h2-9,11H,10H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | SIUKGORQDHTYIW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate?
The IUPAC name of S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate (CID 54307860) is S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate.
What is the SMILES notation for S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate?
The canonical SMILES for S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate is CC1CC(=O)NN=C1c1ccc(NC(=O)Sc2ccc(F)cc2)cc1.
What is the InChIKey of S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate?
The InChIKey is SIUKGORQDHTYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O2S/c1-11-10-16(23)21-22-17(11)12-2-6-14(7-3-12)20-18(24)25-15-8-4-13(19)5-9-15/h2-9,11H,10H2,1H3,(H,20,24)(H,21,23).
What are the key properties of S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate?
S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate has a molecular weight of 357.41 g/mol, XLogP of 4.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-fluorophenyl) N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamothioate is sourced from PubChem (CID 54307860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).