C21H40N2 — CID 54308206
2-octadec-9-en-2-yl-4,5-dihydro-1H-imidazole (PubChem CID 54308206) has the molecular formula C21H40N2 and a molecular weight of 320.56 g/mol. Its IUPAC name is 2-octadec-9-en-2-yl-4,5-dihydro-1H-imidazole.
| Compound Name | 2-octadec-9-en-2-yl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 54308206 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | 2-octadec-9-en-2-yl-4,5-dihydro-1H-imidazole |
| SMILES | CCCCCCCCC=CCCCCCCC(C)C1=NCCN1 |
| InChI | InChI=1S/C21H40N2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(2)21-22-18-19-23-21/h10-11,20H,3-9,12-19H2,1-2H3,(H,22,23) |
| InChIKey | SJAJDNUWMXIGPN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|