C18H19F3N2O2 — CID 54308249
N,N-dimethyl-3-[10-(2,2,2-trifluoroacetyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-4-yl]prop-2-enamide (PubChem CID 54308249) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is N,N-dimethyl-3-[10-(2,2,2-trifluoroacetyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-4-yl]prop-2-enamide.
| Compound Name | N,N-dimethyl-3-[10-(2,2,2-trifluoroacetyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 54308249 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N,N-dimethyl-3-[10-(2,2,2-trifluoroacetyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-4-yl]prop-2-enamide |
| SMILES | CN(C)C(=O)C=Cc1ccc2c(c1)C1CC2CN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H19F3N2O2/c1-22(2)16(24)6-4-11-3-5-14-12-8-13(15(14)7-11)10-23(9-12)17(25)18(19,20)21/h3-7,12-13H,8-10H2,1-2H3 |
| InChIKey | SJBGIIDBFKOIDW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|