C10H14N8O2 — CID 54308256
3,5-diamino-2,4,6-tris(methyldiazenyl)benzoic acid (PubChem CID 54308256) has the molecular formula C10H14N8O2 and a molecular weight of 278.28 g/mol. Its IUPAC name is 3,5-diamino-2,4,6-tris(methyldiazenyl)benzoic acid.
| Compound Name | 3,5-diamino-2,4,6-tris(methyldiazenyl)benzoic acid |
|---|---|
| PubChem CID | 54308256 |
| Molecular Formula | C10H14N8O2 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3,5-diamino-2,4,6-tris(methyldiazenyl)benzoic acid |
| SMILES | C/N=N/c1c(N)c(/N=N/C)c(C(=O)O)c(/N=N/C)c1N |
| InChI | InChI=1S/C10H14N8O2/c1-13-16-7-4(10(19)20)8(17-14-2)6(12)9(5(7)11)18-15-3/h11-12H2,1-3H3,(H,19,20)/b16-13+,17-14+,18-15+ |
| InChIKey | SJBKPWSFWCLTRJ-NLCRRHETSA-N |
| XLogP | 2.69 |
| TPSA | 163.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|